C27H28FN5O3 — CID 169309630
3-[5-fluoro-7-[4-[(4-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309630) has the molecular formula C27H28FN5O3 and a molecular weight of 489.55 g/mol. Its IUPAC name is 3-[5-fluoro-7-[4-[(4-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-7-[4-[(4-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309630 |
| Molecular Formula | C27H28FN5O3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 3-[5-fluoro-7-[4-[(4-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cccc2[nH]cc(CN3CCN(c4cc(F)cc5c4CN(C4CCC(=O)NC4=O)C5=O)CC3)c12 |
| InChI | InChI=1S/C27H28FN5O3/c1-16-3-2-4-21-25(16)17(13-29-21)14-31-7-9-32(10-8-31)23-12-18(28)11-19-20(23)15-33(27(19)36)22-5-6-24(34)30-26(22)35/h2-4,11-13,22,29H,5-10,14-15H2,1H3,(H,30,34,35) |
| InChIKey | LJJOAWKPNNEAPO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|