C26H25FN4O3S — CID 169311669
3-[7-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311669) has the molecular formula C26H25FN4O3S and a molecular weight of 492.58 g/mol. Its IUPAC name is 3-[7-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311669 |
| Molecular Formula | C26H25FN4O3S |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 3-[7-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3N3CCN(Cc4csc5ccccc45)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H25FN4O3S/c27-17-11-19-20(14-31(26(19)34)21-5-6-24(32)28-25(21)33)22(12-17)30-9-7-29(8-10-30)13-16-15-35-23-4-2-1-3-18(16)23/h1-4,11-12,15,21H,5-10,13-14H2,(H,28,32,33) |
| InChIKey | OGJZDVLUTHCHJH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|