C26H26FN5O4 — CID 169309837
3-[5-fluoro-3-oxo-7-[4-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309837) has the molecular formula C26H26FN5O4 and a molecular weight of 491.52 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-7-[4-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-7-[4-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309837 |
| Molecular Formula | C26H26FN5O4 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 3-[5-fluoro-3-oxo-7-[4-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3N3CCN(Cc4ccc5c(c4)C(=O)NC5)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H26FN5O4/c27-17-10-19-20(14-32(26(19)36)21-3-4-23(33)29-25(21)35)22(11-17)31-7-5-30(6-8-31)13-15-1-2-16-12-28-24(34)18(16)9-15/h1-2,9-11,21H,3-8,12-14H2,(H,28,34)(H,29,33,35) |
| InChIKey | SXBIPDYOOZVINP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|