C29H34BrFN6O3 — CID 169310633
3-[7-[4-[[3-bromo-4-(4-methylpiperazin-1-yl)phenyl]methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310633) has the molecular formula C29H34BrFN6O3 and a molecular weight of 613.53 g/mol. Its IUPAC name is 3-[7-[4-[[3-bromo-4-(4-methylpiperazin-1-yl)phenyl]methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[[3-bromo-4-(4-methylpiperazin-1-yl)phenyl]methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310633 |
| Molecular Formula | C29H34BrFN6O3 |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 3-[7-[4-[[3-bromo-4-(4-methylpiperazin-1-yl)phenyl]methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CN1CCN(c2ccc(CN3CCN(c4cc(F)cc5c4CN(C4CCC(=O)NC4=O)C5=O)CC3)cc2Br)CC1 |
| InChI | InChI=1S/C29H34BrFN6O3/c1-33-6-10-35(11-7-33)24-3-2-19(14-23(24)30)17-34-8-12-36(13-9-34)26-16-20(31)15-21-22(26)18-37(29(21)40)25-4-5-27(38)32-28(25)39/h2-3,14-16,25H,4-13,17-18H2,1H3,(H,32,38,39) |
| InChIKey | DREBDSSPIHVRPJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|