C25H24FN5O4 — CID 169310570
5-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]-2-hydroxybenzonitrile (PubChem CID 169310570) has the molecular formula C25H24FN5O4 and a molecular weight of 477.50 g/mol. Its IUPAC name is 5-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]-2-hydroxybenzonitrile.
| Compound Name | 5-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 169310570 |
| Molecular Formula | C25H24FN5O4 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 5-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]-2-hydroxybenzonitrile |
| SMILES | N#Cc1cc(CN2CCN(c3cc(F)cc4c3CN(C3CCC(=O)NC3=O)C4=O)CC2)ccc1O |
| InChI | InChI=1S/C25H24FN5O4/c26-17-10-18-19(14-31(25(18)35)20-2-4-23(33)28-24(20)34)21(11-17)30-7-5-29(6-8-30)13-15-1-3-22(32)16(9-15)12-27/h1,3,9-11,20,32H,2,4-8,13-14H2,(H,28,33,34) |
| InChIKey | QCEOUQLLKIJBEL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|