C26H24F2N4O4 — CID 169310048
3-[5-fluoro-7-[4-[(4-fluoro-1-benzofuran-7-yl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310048) has the molecular formula C26H24F2N4O4 and a molecular weight of 494.50 g/mol. Its IUPAC name is 3-[5-fluoro-7-[4-[(4-fluoro-1-benzofuran-7-yl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-7-[4-[(4-fluoro-1-benzofuran-7-yl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310048 |
| Molecular Formula | C26H24F2N4O4 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 3-[5-fluoro-7-[4-[(4-fluoro-1-benzofuran-7-yl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3N3CCN(Cc4ccc(F)c5ccoc45)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H24F2N4O4/c27-16-11-18-19(14-32(26(18)35)21-3-4-23(33)29-25(21)34)22(12-16)31-8-6-30(7-9-31)13-15-1-2-20(28)17-5-10-36-24(15)17/h1-2,5,10-12,21H,3-4,6-9,13-14H2,(H,29,33,34) |
| InChIKey | NBYGSTRHXPQDNF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|