C26H25FN4O4 — CID 169310196
3-[6-[4-(1-benzofuran-7-ylmethyl)piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310196) has the molecular formula C26H25FN4O4 and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-[6-[4-(1-benzofuran-7-ylmethyl)piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(1-benzofuran-7-ylmethyl)piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310196 |
| Molecular Formula | C26H25FN4O4 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 3-[6-[4-(1-benzofuran-7-ylmethyl)piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(Cc5cccc6ccoc56)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H25FN4O4/c27-20-13-19-18(15-31(26(19)34)21-4-5-23(32)28-25(21)33)12-22(20)30-9-7-29(8-10-30)14-17-3-1-2-16-6-11-35-24(16)17/h1-3,6,11-13,21H,4-5,7-10,14-15H2,(H,28,32,33) |
| InChIKey | DTTDPLGIXYAWPI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|