C26H25FN6O3 — CID 169309537
3-[5-fluoro-3-oxo-6-[4-(quinoxalin-2-ylmethyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309537) has the molecular formula C26H25FN6O3 and a molecular weight of 488.52 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-6-[4-(quinoxalin-2-ylmethyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-6-[4-(quinoxalin-2-ylmethyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309537 |
| Molecular Formula | C26H25FN6O3 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 3-[5-fluoro-3-oxo-6-[4-(quinoxalin-2-ylmethyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(Cc5cnc6ccccc6n5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H25FN6O3/c27-19-12-18-16(14-33(26(18)36)22-5-6-24(34)30-25(22)35)11-23(19)32-9-7-31(8-10-32)15-17-13-28-20-3-1-2-4-21(20)29-17/h1-4,11-13,22H,5-10,14-15H2,(H,30,34,35) |
| InChIKey | STPXCYOYPBQNKS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|