C23H25FN6O3 — CID 169310506
3-[6-[4-[(3-amino-4-pyridinyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310506) has the molecular formula C23H25FN6O3 and a molecular weight of 452.49 g/mol. Its IUPAC name is 3-[6-[4-[(3-amino-4-pyridinyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[(3-amino-4-pyridinyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310506 |
| Molecular Formula | C23H25FN6O3 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-[6-[4-[(3-amino-4-pyridinyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Nc1cnccc1CN1CCN(c2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3)CC1 |
| InChI | InChI=1S/C23H25FN6O3/c24-17-10-16-15(13-30(23(16)33)19-1-2-21(31)27-22(19)32)9-20(17)29-7-5-28(6-8-29)12-14-3-4-26-11-18(14)25/h3-4,9-11,19H,1-2,5-8,12-13,25H2,(H,27,31,32) |
| InChIKey | NANODMSIKAIGMB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|