C26H29FN4O5S — CID 169309506
3-[6-[4-[(4-ethylsulfonylphenyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309506) has the molecular formula C26H29FN4O5S and a molecular weight of 528.61 g/mol. Its IUPAC name is 3-[6-[4-[(4-ethylsulfonylphenyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[(4-ethylsulfonylphenyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309506 |
| Molecular Formula | C26H29FN4O5S |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 3-[6-[4-[(4-ethylsulfonylphenyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCS(=O)(=O)c1ccc(CN2CCN(c3cc4c(cc3F)C(=O)N(C3CCC(=O)NC3=O)C4)CC2)cc1 |
| InChI | InChI=1S/C26H29FN4O5S/c1-2-37(35,36)19-5-3-17(4-6-19)15-29-9-11-30(12-10-29)23-13-18-16-31(26(34)20(18)14-21(23)27)22-7-8-24(32)28-25(22)33/h3-6,13-14,22H,2,7-12,15-16H2,1H3,(H,28,32,33) |
| InChIKey | AQOXUUFRXODLGK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|