C28H32FN5O4 — CID 169310350
3-[5-fluoro-6-[4-[(4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310350) has the molecular formula C28H32FN5O4 and a molecular weight of 521.59 g/mol. Its IUPAC name is 3-[5-fluoro-6-[4-[(4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-[4-[(4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310350 |
| Molecular Formula | C28H32FN5O4 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 3-[5-fluoro-6-[4-[(4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(Cc5ccc(N6CCOCC6)cc5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H32FN5O4/c29-23-16-22-20(18-34(28(22)37)24-5-6-26(35)30-27(24)36)15-25(23)33-9-7-31(8-10-33)17-19-1-3-21(4-2-19)32-11-13-38-14-12-32/h1-4,15-16,24H,5-14,17-18H2,(H,30,35,36) |
| InChIKey | RQWSYKJMMKBSTH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|