C28H31ClFN5O4 — CID 169309682
3-[7-[4-[(3-chloro-4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309682) has the molecular formula C28H31ClFN5O4 and a molecular weight of 556.04 g/mol. Its IUPAC name is 3-[7-[4-[(3-chloro-4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[(3-chloro-4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309682 |
| Molecular Formula | C28H31ClFN5O4 |
| Molecular Weight | 556.04 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 3-[7-[4-[(3-chloro-4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3N3CCN(Cc4ccc(N5CCOCC5)c(Cl)c4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H31ClFN5O4/c29-22-13-18(1-2-23(22)34-9-11-39-12-10-34)16-32-5-7-33(8-6-32)25-15-19(30)14-20-21(25)17-35(28(20)38)24-3-4-26(36)31-27(24)37/h1-2,13-15,24H,3-12,16-17H2,(H,31,36,37) |
| InChIKey | HRWORIAFJBUXSF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.04 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|