C25H26FN5O4 — CID 169311524
3-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]benzamide (PubChem CID 169311524) has the molecular formula C25H26FN5O4 and a molecular weight of 479.51 g/mol. Its IUPAC name is 3-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]benzamide.
| Compound Name | 3-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 169311524 |
| Molecular Formula | C25H26FN5O4 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 3-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CN2CCN(c3cc(F)cc4c3CN(C3CCC(=O)NC3=O)C4=O)CC2)c1 |
| InChI | InChI=1S/C25H26FN5O4/c26-17-11-18-19(14-31(25(18)35)20-4-5-22(32)28-24(20)34)21(12-17)30-8-6-29(7-9-30)13-15-2-1-3-16(10-15)23(27)33/h1-3,10-12,20H,4-9,13-14H2,(H2,27,33)(H,28,32,34) |
| InChIKey | PLMMLZCJWLHWIH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|