C25H26FN5O6S — CID 169310359
N-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]sulfonylphenyl]acetamide (PubChem CID 169310359) has the molecular formula C25H26FN5O6S and a molecular weight of 543.58 g/mol. Its IUPAC name is N-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 169310359 |
| Molecular Formula | C25H26FN5O6S |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | N-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(c3cc4c(cc3F)C(=O)N(C3CCC(=O)NC3=O)C4)CC2)cc1 |
| InChI | InChI=1S/C25H26FN5O6S/c1-15(32)27-17-2-4-18(5-3-17)38(36,37)30-10-8-29(9-11-30)22-12-16-14-31(25(35)19(16)13-20(22)26)21-6-7-23(33)28-24(21)34/h2-5,12-13,21H,6-11,14H2,1H3,(H,27,32)(H,28,33,34) |
| InChIKey | VYDBNZRGCBREFC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|