C21H20ClFN4O5S2 — CID 169311732
3-[6-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311732) has the molecular formula C21H20ClFN4O5S2 and a molecular weight of 527.00 g/mol. Its IUPAC name is 3-[6-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311732 |
| Molecular Formula | C21H20ClFN4O5S2 |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 3-[6-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(S(=O)(=O)c5ccc(Cl)s5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H20ClFN4O5S2/c22-17-2-4-19(33-17)34(31,32)26-7-5-25(6-8-26)16-9-12-11-27(21(30)13(12)10-14(16)23)15-1-3-18(28)24-20(15)29/h2,4,9-10,15H,1,3,5-8,11H2,(H,24,28,29) |
| InChIKey | QOIUHPAGKBOTEZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|