C25H27FN4O5S — CID 169311161
3-[6-[4-(2,6-dimethylphenyl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311161) has the molecular formula C25H27FN4O5S and a molecular weight of 514.58 g/mol. Its IUPAC name is 3-[6-[4-(2,6-dimethylphenyl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(2,6-dimethylphenyl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311161 |
| Molecular Formula | C25H27FN4O5S |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 3-[6-[4-(2,6-dimethylphenyl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cccc(C)c1S(=O)(=O)N1CCN(c2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3)CC1 |
| InChI | InChI=1S/C25H27FN4O5S/c1-15-4-3-5-16(2)23(15)36(34,35)29-10-8-28(9-11-29)21-12-17-14-30(25(33)18(17)13-19(21)26)20-6-7-22(31)27-24(20)32/h3-5,12-13,20H,6-11,14H2,1-2H3,(H,27,31,32) |
| InChIKey | VNCKOCOIPCWNSO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|