C20H22F4N4O5S — CID 169310616
3-[5-fluoro-3-oxo-6-[4-(3,3,3-trifluoropropylsulfonyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310616) has the molecular formula C20H22F4N4O5S and a molecular weight of 506.48 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-6-[4-(3,3,3-trifluoropropylsulfonyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-6-[4-(3,3,3-trifluoropropylsulfonyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310616 |
| Molecular Formula | C20H22F4N4O5S |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 3-[5-fluoro-3-oxo-6-[4-(3,3,3-trifluoropropylsulfonyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(S(=O)(=O)CCC(F)(F)F)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H22F4N4O5S/c21-14-10-13-12(11-28(19(13)31)15-1-2-17(29)25-18(15)30)9-16(14)26-4-6-27(7-5-26)34(32,33)8-3-20(22,23)24/h9-10,15H,1-8,11H2,(H,25,29,30) |
| InChIKey | UQKNHYHVAPXPFU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|