C24H21ClFN5O5S — CID 169311384
3-[6-[4-(2-chloro-4-isocyanophenyl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311384) has the molecular formula C24H21ClFN5O5S and a molecular weight of 545.98 g/mol. Its IUPAC name is 3-[6-[4-(2-chloro-4-isocyanophenyl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(2-chloro-4-isocyanophenyl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311384 |
| Molecular Formula | C24H21ClFN5O5S |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 3-[6-[4-(2-chloro-4-isocyanophenyl)sulfonylpiperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [C-]#[N+]c1ccc(S(=O)(=O)N2CCN(c3cc4c(cc3F)C(=O)N(C3CCC(=O)NC3=O)C4)CC2)c(Cl)c1 |
| InChI | InChI=1S/C24H21ClFN5O5S/c1-27-15-2-4-21(17(25)11-15)37(35,36)30-8-6-29(7-9-30)20-10-14-13-31(24(34)16(14)12-18(20)26)19-3-5-22(32)28-23(19)33/h2,4,10-12,19H,3,5-9,13H2,(H,28,32,33) |
| InChIKey | UEOOSLGBDFRCNA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|