C26H28FN3O5S — CID 169310518
3-[5-fluoro-3-oxo-6-[1-(2-phenylethylsulfonyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310518) has the molecular formula C26H28FN3O5S and a molecular weight of 513.59 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-6-[1-(2-phenylethylsulfonyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-6-[1-(2-phenylethylsulfonyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310518 |
| Molecular Formula | C26H28FN3O5S |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 3-[5-fluoro-3-oxo-6-[1-(2-phenylethylsulfonyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(S(=O)(=O)CCc5ccccc5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H28FN3O5S/c27-22-15-21-19(16-30(26(21)33)23-6-7-24(31)28-25(23)32)14-20(22)18-8-11-29(12-9-18)36(34,35)13-10-17-4-2-1-3-5-17/h1-5,14-15,18,23H,6-13,16H2,(H,28,31,32) |
| InChIKey | WQRSNETWQDGISC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|