C29H27FN4O6S — CID 169310352
3-[5-fluoro-3-oxo-6-[1-(4-pyridin-2-yloxyphenyl)sulfonylpiperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310352) has the molecular formula C29H27FN4O6S and a molecular weight of 578.62 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-6-[1-(4-pyridin-2-yloxyphenyl)sulfonylpiperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-6-[1-(4-pyridin-2-yloxyphenyl)sulfonylpiperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310352 |
| Molecular Formula | C29H27FN4O6S |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 3-[5-fluoro-3-oxo-6-[1-(4-pyridin-2-yloxyphenyl)sulfonylpiperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(S(=O)(=O)c5ccc(Oc6ccccn6)cc5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H27FN4O6S/c30-24-16-23-19(17-34(29(23)37)25-8-9-26(35)32-28(25)36)15-22(24)18-10-13-33(14-11-18)41(38,39)21-6-4-20(5-7-21)40-27-3-1-2-12-31-27/h1-7,12,15-16,18,25H,8-11,13-14,17H2,(H,32,35,36) |
| InChIKey | HNFKMNTWHZKZMT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|