C26H27FN4O6S — CID 169311218
4-[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]sulfonyl-N-methylbenzamide (PubChem CID 169311218) has the molecular formula C26H27FN4O6S and a molecular weight of 542.59 g/mol. Its IUPAC name is 4-[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]sulfonyl-N-methylbenzamide.
| Compound Name | 4-[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]sulfonyl-N-methylbenzamide |
|---|---|
| PubChem CID | 169311218 |
| Molecular Formula | C26H27FN4O6S |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 4-[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]sulfonyl-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)N2CCC(c3cc4c(cc3F)C(=O)N(C3CCC(=O)NC3=O)C4)CC2)cc1 |
| InChI | InChI=1S/C26H27FN4O6S/c1-28-24(33)16-2-4-18(5-3-16)38(36,37)30-10-8-15(9-11-30)19-12-17-14-31(26(35)20(17)13-21(19)27)22-6-7-23(32)29-25(22)34/h2-5,12-13,15,22H,6-11,14H2,1H3,(H,28,33)(H,29,32,34) |
| InChIKey | WARGNLNBHHXKIP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|