C23H27FN4O4 — CID 169311089
3-[5-fluoro-6-[1-(1-methylazetidine-3-carbonyl)piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311089) has the molecular formula C23H27FN4O4 and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-[5-fluoro-6-[1-(1-methylazetidine-3-carbonyl)piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-[1-(1-methylazetidine-3-carbonyl)piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311089 |
| Molecular Formula | C23H27FN4O4 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 3-[5-fluoro-6-[1-(1-methylazetidine-3-carbonyl)piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CN1CC(C(=O)N2CCC(c3cc4c(cc3F)C(=O)N(C3CCC(=O)NC3=O)C4)CC2)C1 |
| InChI | InChI=1S/C23H27FN4O4/c1-26-10-15(11-26)22(31)27-6-4-13(5-7-27)16-8-14-12-28(23(32)17(14)9-18(16)24)19-2-3-20(29)25-21(19)30/h8-9,13,15,19H,2-7,10-12H2,1H3,(H,25,29,30) |
| InChIKey | ALZUIBSELGSUNV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|