C28H30FN3O3 — CID 169311425
3-[6-[1-[(4-cyclopropylphenyl)methyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311425) has the molecular formula C28H30FN3O3 and a molecular weight of 475.56 g/mol. Its IUPAC name is 3-[6-[1-[(4-cyclopropylphenyl)methyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[(4-cyclopropylphenyl)methyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311425 |
| Molecular Formula | C28H30FN3O3 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 3-[6-[1-[(4-cyclopropylphenyl)methyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(Cc5ccc(C6CC6)cc5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H30FN3O3/c29-24-14-23-21(16-32(28(23)35)25-7-8-26(33)30-27(25)34)13-22(24)20-9-11-31(12-10-20)15-17-1-3-18(4-2-17)19-5-6-19/h1-4,13-14,19-20,25H,5-12,15-16H2,(H,30,33,34) |
| InChIKey | VPOBNVNWTPGGDY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|