C27H27FN4O4 — CID 169311100
3-[5-fluoro-6-[1-[(4-isocyano-3-methoxyphenyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311100) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is 3-[5-fluoro-6-[1-[(4-isocyano-3-methoxyphenyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-[1-[(4-isocyano-3-methoxyphenyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311100 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 3-[5-fluoro-6-[1-[(4-isocyano-3-methoxyphenyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [C-]#[N+]c1ccc(CN2CCC(c3cc4c(cc3F)C(=O)N(C3CCC(=O)NC3=O)C4)CC2)cc1OC |
| InChI | InChI=1S/C27H27FN4O4/c1-29-22-4-3-16(11-24(22)36-2)14-31-9-7-17(8-10-31)19-12-18-15-32(27(35)20(18)13-21(19)28)23-5-6-25(33)30-26(23)34/h3-4,11-13,17,23H,5-10,14-15H2,2H3,(H,30,33,34) |
| InChIKey | LZQAYMFWARYRJP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|