C31H30FN3O3 — CID 169311627
3-[5-fluoro-3-oxo-6-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311627) has the molecular formula C31H30FN3O3 and a molecular weight of 511.60 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-6-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-6-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311627 |
| Molecular Formula | C31H30FN3O3 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 3-[5-fluoro-3-oxo-6-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(Cc5ccc(-c6ccccc6)cc5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H30FN3O3/c32-27-17-26-24(19-35(31(26)38)28-10-11-29(36)33-30(28)37)16-25(27)23-12-14-34(15-13-23)18-20-6-8-22(9-7-20)21-4-2-1-3-5-21/h1-9,16-17,23,28H,10-15,18-19H2,(H,33,36,37) |
| InChIKey | UBOXKSLTKUOUBD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|