C23H23ClFN3O3S — CID 169309755
3-[6-[1-[(2-chlorothiophen-3-yl)methyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309755) has the molecular formula C23H23ClFN3O3S and a molecular weight of 475.97 g/mol. Its IUPAC name is 3-[6-[1-[(2-chlorothiophen-3-yl)methyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[(2-chlorothiophen-3-yl)methyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309755 |
| Molecular Formula | C23H23ClFN3O3S |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 3-[6-[1-[(2-chlorothiophen-3-yl)methyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(Cc5ccsc5Cl)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H23ClFN3O3S/c24-21-14(5-8-32-21)11-27-6-3-13(4-7-27)16-9-15-12-28(23(31)17(15)10-18(16)25)19-1-2-20(29)26-22(19)30/h5,8-10,13,19H,1-4,6-7,11-12H2,(H,26,29,30) |
| InChIKey | MHLYJCNWYUSQKU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|