C18H21ClFN3O3 — CID 156787370
3-(5-fluoro-3-oxo-6-piperidin-4-yl-1H-isoindol-2-yl)piperidine-2,6-dione;hydrochloride (PubChem CID 156787370) has the molecular formula C18H21ClFN3O3 and a molecular weight of 381.84 g/mol. Its IUPAC name is 3-(5-fluoro-3-oxo-6-piperidin-4-yl-1H-isoindol-2-yl)piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-(5-fluoro-3-oxo-6-piperidin-4-yl-1H-isoindol-2-yl)piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 156787370 |
| Molecular Formula | C18H21ClFN3O3 |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-(5-fluoro-3-oxo-6-piperidin-4-yl-1H-isoindol-2-yl)piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(N2Cc3cc(C4CCNCC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H20FN3O3.ClH/c19-14-8-13-11(7-12(14)10-3-5-20-6-4-10)9-22(18(13)25)15-1-2-16(23)21-17(15)24;/h7-8,10,15,20H,1-6,9H2,(H,21,23,24);1H |
| InChIKey | YLQTZFLVQCOKOC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|