C18H18FN3O4 — CID 170313071
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-piperidin-4-ylisoindole-1,3-dione (PubChem CID 170313071) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-piperidin-4-ylisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-piperidin-4-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 170313071 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-piperidin-4-ylisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cc(F)c(C4CCNCC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H18FN3O4/c19-13-8-12-11(7-10(13)9-3-5-20-6-4-9)17(25)22(18(12)26)14-1-2-15(23)21-16(14)24/h7-9,14,20H,1-6H2,(H,21,23,24) |
| InChIKey | QNOOWQFPGVKIDL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|