C14H10BrFN2O4 — CID 168871458
5-(bromomethyl)-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione (PubChem CID 168871458) has the molecular formula C14H10BrFN2O4 and a molecular weight of 369.15 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione.
| Compound Name | 5-(bromomethyl)-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 168871458 |
| Molecular Formula | C14H10BrFN2O4 |
| Molecular Weight | 369.15 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 5-(bromomethyl)-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cc(F)c(CBr)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C14H10BrFN2O4/c15-5-6-3-7-8(4-9(6)16)14(22)18(13(7)21)10-1-2-11(19)17-12(10)20/h3-4,10H,1-2,5H2,(H,17,19,20) |
| InChIKey | PEGBLUUGLLSVLA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|