C14H12FN3O4 — CID 167088360
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-(methylamino)isoindole-1,3-dione (PubChem CID 167088360) has the molecular formula C14H12FN3O4 and a molecular weight of 305.27 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-(methylamino)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-(methylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167088360 |
| Molecular Formula | C14H12FN3O4 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-(methylamino)isoindole-1,3-dione |
| SMILES | CNc1cc2c(cc1F)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H12FN3O4/c1-16-9-5-7-6(4-8(9)15)13(21)18(14(7)22)10-2-3-11(19)17-12(10)20/h4-5,10,16H,2-3H2,1H3,(H,17,19,20) |
| InChIKey | BDDBTETVLBGJNL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|