C16H14FN3O6 — CID 171158327
2-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]propanoic acid (PubChem CID 171158327) has the molecular formula C16H14FN3O6 and a molecular weight of 363.30 g/mol. Its IUPAC name is 2-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]propanoic acid.
| Compound Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 171158327 |
| Molecular Formula | C16H14FN3O6 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]propanoic acid |
| SMILES | CC(Nc1cc2c(cc1F)C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)O |
| InChI | InChI=1S/C16H14FN3O6/c1-6(16(25)26)18-10-5-8-7(4-9(10)17)14(23)20(15(8)24)11-2-3-12(21)19-13(11)22/h4-6,11,18H,2-3H2,1H3,(H,25,26)(H,19,21,22) |
| InChIKey | MAMFITNWLARKLE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|