C22H28FN3O5 — CID 167513364
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[[2-methyl-2-(3-methylbutoxy)propyl]amino]isoindole-1,3-dione (PubChem CID 167513364) has the molecular formula C22H28FN3O5 and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[[2-methyl-2-(3-methylbutoxy)propyl]amino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[[2-methyl-2-(3-methylbutoxy)propyl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167513364 |
| Molecular Formula | C22H28FN3O5 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[[2-methyl-2-(3-methylbutoxy)propyl]amino]isoindole-1,3-dione |
| SMILES | CC(C)CCOC(C)(C)CNc1cc2c(cc1F)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H28FN3O5/c1-12(2)7-8-31-22(3,4)11-24-16-10-14-13(9-15(16)23)20(29)26(21(14)30)17-5-6-18(27)25-19(17)28/h9-10,12,17,24H,5-8,11H2,1-4H3,(H,25,27,28) |
| InChIKey | MITJTKWWIODRGE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|