C18H16FN3O5 — CID 155331711
3-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]cyclobutane-1-carbaldehyde (PubChem CID 155331711) has the molecular formula C18H16FN3O5 and a molecular weight of 373.34 g/mol. Its IUPAC name is 3-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]cyclobutane-1-carbaldehyde.
| Compound Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 155331711 |
| Molecular Formula | C18H16FN3O5 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]cyclobutane-1-carbaldehyde |
| SMILES | O=CC1CC(Nc2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C18H16FN3O5/c19-12-5-10-11(6-13(12)20-9-3-8(4-9)7-23)18(27)22(17(10)26)14-1-2-15(24)21-16(14)25/h5-9,14,20H,1-4H2,(H,21,24,25) |
| InChIKey | AWIRIUVLBFOUJE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|