C31H28ClFN4O4 — CID 171829304
5-[(1-benzhydryl-5-chloropiperidin-3-yl)amino]-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione (PubChem CID 171829304) has the molecular formula C31H28ClFN4O4 and a molecular weight of 575.04 g/mol. Its IUPAC name is 5-[(1-benzhydryl-5-chloropiperidin-3-yl)amino]-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione.
| Compound Name | 5-[(1-benzhydryl-5-chloropiperidin-3-yl)amino]-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 171829304 |
| Molecular Formula | C31H28ClFN4O4 |
| Molecular Weight | 575.04 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 5-[(1-benzhydryl-5-chloropiperidin-3-yl)amino]-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cc(F)c(NC4CC(Cl)CN(C(c5ccccc5)c5ccccc5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H28ClFN4O4/c32-20-13-21(17-36(16-20)28(18-7-3-1-4-8-18)19-9-5-2-6-10-19)34-25-15-23-22(14-24(25)33)30(40)37(31(23)41)26-11-12-27(38)35-29(26)39/h1-10,14-15,20-21,26,28,34H,11-13,16-17H2,(H,35,38,39) |
| InChIKey | AUNOHBNLYKJEDV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.04 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|