C19H15N3O6 — CID 172549870
7-(2,6-dioxopiperidin-3-yl)-3a,4,10,10a-tetrahydroisoindolo[5,6-f]isoindole-1,3,6,8-tetrone (PubChem CID 172549870) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is 7-(2,6-dioxopiperidin-3-yl)-3a,4,10,10a-tetrahydroisoindolo[5,6-f]isoindole-1,3,6,8-tetrone.
| Compound Name | 7-(2,6-dioxopiperidin-3-yl)-3a,4,10,10a-tetrahydroisoindolo[5,6-f]isoindole-1,3,6,8-tetrone |
|---|---|
| PubChem CID | 172549870 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 7-(2,6-dioxopiperidin-3-yl)-3a,4,10,10a-tetrahydroisoindolo[5,6-f]isoindole-1,3,6,8-tetrone |
| SMILES | O=C1CCC(N2C(=O)c3cc4c(cc3C2=O)CC2C(=O)NC(=O)C2C4)C(=O)N1 |
| InChI | InChI=1S/C19H15N3O6/c23-14-2-1-13(17(26)20-14)22-18(27)11-5-7-3-9-10(16(25)21-15(9)24)4-8(7)6-12(11)19(22)28/h5-6,9-10,13H,1-4H2,(H,20,23,26)(H,21,24,25) |
| InChIKey | UDGBZHMWDIFNPZ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|