C15H10N4O4 — CID 171588178
7-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-g]phthalazine-6,8-dione (PubChem CID 171588178) has the molecular formula C15H10N4O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is 7-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-g]phthalazine-6,8-dione.
| Compound Name | 7-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-g]phthalazine-6,8-dione |
|---|---|
| PubChem CID | 171588178 |
| Molecular Formula | C15H10N4O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 7-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-g]phthalazine-6,8-dione |
| SMILES | O=C1CCC(N2C(=O)c3cc4cnncc4cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H10N4O4/c20-12-2-1-11(13(21)18-12)19-14(22)9-3-7-5-16-17-6-8(7)4-10(9)15(19)23/h3-6,11H,1-2H2,(H,18,20,21) |
| InChIKey | AOEHDQYWDFCVAD-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|