C15H17N3O4 — CID 164919630
2-(2,6-dioxopiperidin-3-yl)-6-methylpyrrolo[3,4-c]pyridine-1,3-dione;ethane (PubChem CID 164919630) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-6-methylpyrrolo[3,4-c]pyridine-1,3-dione;ethane.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-6-methylpyrrolo[3,4-c]pyridine-1,3-dione;ethane |
|---|---|
| PubChem CID | 164919630 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-6-methylpyrrolo[3,4-c]pyridine-1,3-dione;ethane |
| SMILES | CC.Cc1cc2c(cn1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H11N3O4.C2H6/c1-6-4-7-8(5-14-6)13(20)16(12(7)19)9-2-3-10(17)15-11(9)18;1-2/h4-5,9H,2-3H2,1H3,(H,15,17,18);1-2H3 |
| InChIKey | OGCFRUYHAZMLAD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|