C12H8ClN3O4 — CID 155905642
6-chloro-2-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 155905642) has the molecular formula C12H8ClN3O4 and a molecular weight of 293.67 g/mol. Its IUPAC name is 6-chloro-2-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 6-chloro-2-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 155905642 |
| Molecular Formula | C12H8ClN3O4 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 6-chloro-2-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cnc(Cl)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C12H8ClN3O4/c13-8-3-5-6(4-14-8)12(20)16(11(5)19)7-1-2-9(17)15-10(7)18/h3-4,7H,1-2H2,(H,15,17,18) |
| InChIKey | JYDRTXDIBJBNDP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|