C18H14N4O4S — CID 167753951
2-(2,6-dioxopiperidin-3-yl)-5-(6-methylpyrimidin-4-yl)sulfanylisoindole-1,3-dione (PubChem CID 167753951) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-(6-methylpyrimidin-4-yl)sulfanylisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-(6-methylpyrimidin-4-yl)sulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 167753951 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-(6-methylpyrimidin-4-yl)sulfanylisoindole-1,3-dione |
| SMILES | Cc1cc(Sc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)ncn1 |
| InChI | InChI=1S/C18H14N4O4S/c1-9-6-15(20-8-19-9)27-10-2-3-11-12(7-10)18(26)22(17(11)25)13-4-5-14(23)21-16(13)24/h2-3,6-8,13H,4-5H2,1H3,(H,21,23,24) |
| InChIKey | DGDRYPZCTXVIJZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|