C13H11BN2O6 — CID 177125946
[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]boronic acid (PubChem CID 177125946) has the molecular formula C13H11BN2O6 and a molecular weight of 302.05 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]boronic acid.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]boronic acid |
|---|---|
| PubChem CID | 177125946 |
| Molecular Formula | C13H11BN2O6 |
| Molecular Weight | 302.05 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]boronic acid |
| SMILES | O=C1CCC(N2C(=O)c3ccc(B(O)O)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H11BN2O6/c17-10-4-3-9(11(18)15-10)16-12(19)7-2-1-6(14(21)22)5-8(7)13(16)20/h1-2,5,9,21-22H,3-4H2,(H,15,17,18) |
| InChIKey | JNMWWEJHFXTLHL-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.05 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|