C15H12N2O6 — CID 166784786
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-hydroxyacetaldehyde (PubChem CID 166784786) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-hydroxyacetaldehyde.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-hydroxyacetaldehyde |
|---|---|
| PubChem CID | 166784786 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-hydroxyacetaldehyde |
| SMILES | O=CC(O)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H12N2O6/c18-6-11(19)7-1-2-8-9(5-7)15(23)17(14(8)22)10-3-4-12(20)16-13(10)21/h1-2,5-6,10-11,19H,3-4H2,(H,16,20,21) |
| InChIKey | VZIWFVDZCGFBEM-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|