C16H15N3O5 — CID 164920224
8-[(3R)-2,6-dioxopiperidin-3-yl]-2,3,4,5-tetrahydropyrrolo[3,4-h][1,4]benzoxazepine-7,9-dione (PubChem CID 164920224) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 8-[(3R)-2,6-dioxopiperidin-3-yl]-2,3,4,5-tetrahydropyrrolo[3,4-h][1,4]benzoxazepine-7,9-dione.
| Compound Name | 8-[(3R)-2,6-dioxopiperidin-3-yl]-2,3,4,5-tetrahydropyrrolo[3,4-h][1,4]benzoxazepine-7,9-dione |
|---|---|
| PubChem CID | 164920224 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 8-[(3R)-2,6-dioxopiperidin-3-yl]-2,3,4,5-tetrahydropyrrolo[3,4-h][1,4]benzoxazepine-7,9-dione |
| SMILES | O=C1CC[C@@H](N2C(=O)c3cc4c(cc3C2=O)OCCNC4)C(=O)N1 |
| InChI | InChI=1S/C16H15N3O5/c20-13-2-1-11(14(21)18-13)19-15(22)9-5-8-7-17-3-4-24-12(8)6-10(9)16(19)23/h5-6,11,17H,1-4,7H2,(H,18,20,21)/t11-/m1/s1 |
| InChIKey | LDFXWSDEAXIUGB-LLVKDONJSA-N |
| XLogP | -0.43 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|