C14H12N4O4 — CID 171588270
5-(2,6-dioxopiperidin-3-yl)-2,5,11-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene-4,6-dione (PubChem CID 171588270) has the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. Its IUPAC name is 5-(2,6-dioxopiperidin-3-yl)-2,5,11-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene-4,6-dione.
| Compound Name | 5-(2,6-dioxopiperidin-3-yl)-2,5,11-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene-4,6-dione |
|---|---|
| PubChem CID | 171588270 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5-(2,6-dioxopiperidin-3-yl)-2,5,11-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene-4,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cc4c(nc3C2=O)CNC4)C(=O)N1 |
| InChI | InChI=1S/C14H12N4O4/c19-10-2-1-9(12(20)17-10)18-13(21)7-3-6-4-15-5-8(6)16-11(7)14(18)22/h3,9,15H,1-2,4-5H2,(H,17,19,20) |
| InChIKey | ZDSWTZHFLDQGAT-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|