C15H16N4O4 — CID 138046345
6-(dimethylamino)-2-(2,6-dioxopiperidin-3-yl)-4-methylpyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 138046345) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 6-(dimethylamino)-2-(2,6-dioxopiperidin-3-yl)-4-methylpyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 6-(dimethylamino)-2-(2,6-dioxopiperidin-3-yl)-4-methylpyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 138046345 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 6-(dimethylamino)-2-(2,6-dioxopiperidin-3-yl)-4-methylpyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | Cc1nc(N(C)C)cc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H16N4O4/c1-7-12-8(6-10(16-7)18(2)3)14(22)19(15(12)23)9-4-5-11(20)17-13(9)21/h6,9H,4-5H2,1-3H3,(H,17,20,21) |
| InChIKey | RKGPCSSCONZKOY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|