C23H27FN4O5 — CID 167088586
4-[[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]methyl]-N-ethylcyclohexane-1-carboxamide (PubChem CID 167088586) has the molecular formula C23H27FN4O5 and a molecular weight of 458.49 g/mol. Its IUPAC name is 4-[[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]methyl]-N-ethylcyclohexane-1-carboxamide.
| Compound Name | 4-[[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]methyl]-N-ethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167088586 |
| Molecular Formula | C23H27FN4O5 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4-[[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]amino]methyl]-N-ethylcyclohexane-1-carboxamide |
| SMILES | CCNC(=O)C1CCC(CNc2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C23H27FN4O5/c1-2-25-20(30)13-5-3-12(4-6-13)11-26-17-10-15-14(9-16(17)24)22(32)28(23(15)33)18-7-8-19(29)27-21(18)31/h9-10,12-13,18,26H,2-8,11H2,1H3,(H,25,30)(H,27,29,31) |
| InChIKey | HPSMRVXUQXZFRJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|