C21H24FN5O5 — CID 171158263
N-(2-aminoethyl)-1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperidine-3-carboxamide (PubChem CID 171158263) has the molecular formula C21H24FN5O5 and a molecular weight of 445.45 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171158263 |
| Molecular Formula | C21H24FN5O5 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(c2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C21H24FN5O5/c22-14-8-12-13(21(32)27(20(12)31)15-3-4-17(28)25-19(15)30)9-16(14)26-7-1-2-11(10-26)18(29)24-6-5-23/h8-9,11,15H,1-7,10,23H2,(H,24,29)(H,25,28,30) |
| InChIKey | SOFVWNDKIXQIKP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|