C21H20FN3O5 — CID 169258057
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-(2-oxo-7-azaspiro[3.5]nonan-7-yl)isoindole-1,3-dione (PubChem CID 169258057) has the molecular formula C21H20FN3O5 and a molecular weight of 413.41 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-(2-oxo-7-azaspiro[3.5]nonan-7-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-(2-oxo-7-azaspiro[3.5]nonan-7-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 169258057 |
| Molecular Formula | C21H20FN3O5 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-(2-oxo-7-azaspiro[3.5]nonan-7-yl)isoindole-1,3-dione |
| SMILES | O=C1CC2(CCN(c3cc4c(cc3F)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)C1 |
| InChI | InChI=1S/C21H20FN3O5/c22-14-7-12-13(8-16(14)24-5-3-21(4-6-24)9-11(26)10-21)20(30)25(19(12)29)15-1-2-17(27)23-18(15)28/h7-8,15H,1-6,9-10H2,(H,23,27,28) |
| InChIKey | GJVVIPIVSHOLCI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|