C19H18FN3O6 — CID 171158239
2-[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]pyrrolidin-3-yl]acetic acid (PubChem CID 171158239) has the molecular formula C19H18FN3O6 and a molecular weight of 403.37 g/mol. Its IUPAC name is 2-[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]pyrrolidin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]pyrrolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 171158239 |
| Molecular Formula | C19H18FN3O6 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]pyrrolidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(c2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C19H18FN3O6/c20-12-6-10-11(7-14(12)22-4-3-9(8-22)5-16(25)26)19(29)23(18(10)28)13-1-2-15(24)21-17(13)27/h6-7,9,13H,1-5,8H2,(H,25,26)(H,21,24,27) |
| InChIKey | IOYJNGHSTSZTRN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|