C20H21FN4O5 — CID 175947990
2-[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperidin-4-yl]acetamide (PubChem CID 175947990) has the molecular formula C20H21FN4O5 and a molecular weight of 416.41 g/mol. Its IUPAC name is 2-[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 175947990 |
| Molecular Formula | C20H21FN4O5 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperidin-4-yl]acetamide |
| SMILES | NC(=O)CC1CCN(c2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C20H21FN4O5/c21-13-8-11-12(9-15(13)24-5-3-10(4-6-24)7-16(22)26)20(30)25(19(11)29)14-1-2-17(27)23-18(14)28/h8-10,14H,1-7H2,(H2,22,26)(H,23,27,28) |
| InChIKey | RAAIXVGGHOXDDI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|