C18H20ClFN4O4 — CID 171705556
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[(3S)-3-methylpiperazin-1-yl]isoindole-1,3-dione;hydrochloride (PubChem CID 171705556) has the molecular formula C18H20ClFN4O4 and a molecular weight of 410.83 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[(3S)-3-methylpiperazin-1-yl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[(3S)-3-methylpiperazin-1-yl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 171705556 |
| Molecular Formula | C18H20ClFN4O4 |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[(3S)-3-methylpiperazin-1-yl]isoindole-1,3-dione;hydrochloride |
| SMILES | C[C@H]1CN(c2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3=O)CCN1.Cl |
| InChI | InChI=1S/C18H19FN4O4.ClH/c1-9-8-22(5-4-20-9)14-7-11-10(6-12(14)19)17(26)23(18(11)27)13-2-3-15(24)21-16(13)25;/h6-7,9,13,20H,2-5,8H2,1H3,(H,21,24,25);1H/t9-,13?;/m0./s1 |
| InChIKey | KHRUUOUUJXUUQX-LEMICQRHSA-N |
| XLogP | 0.45 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|